Online Database of Chemicals from Around the World
|
CAS#: 93803-61-3 Product: 2,2'-Methylenebis(4,6-diisopropylphenol) No suppilers available for the product. |
| Name | 2,2'-Methylenebis(4,6-diisopropylphenol) |
|---|---|
| Synonyms | 2,2'-methylenebis[4,6-diisopropylphenol] |
| Molecular Structure |  |
| Molecular Formula | C25H36O2 |
| Molecular Weight | 368.55 |
| CAS Registry Number | 93803-61-3 |
| EINECS | 298-333-1 |
| SMILES | CC(C)c2cc(cc(Cc1cc(cc(C(C)C)c1O)C(C)C)c2O)C(C)C |
| InChI | 1S/C25H36O2/c1-14(2)18-9-20(24(26)22(12-18)16(5)6)11-21-10-19(15(3)4)13-23(17(7)8)25(21)27/h9-10,12-17,26-27H,11H2,1-8H3 |
| InChIKey | VEQGPPAIMRVTQA-UHFFFAOYSA-N |
| Density | 1.007g/cm3 (Cal.) |
|---|---|
| Boiling point | 458.728°C at 760 mmHg (Cal.) |
| Flash point | 191.106°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,2'-Methylenebis(4,6-diisopropylphenol) |