Online Database of Chemicals from Around the World
|
CAS#: 156900-92-4 Product: Tetrahydropentalenolactone No suppilers available for the product. |
| Name | Tetrahydropentalenolactone |
|---|---|
| Molecular Structure |  |
| Molecular Formula | C15H20O5 |
| Molecular Weight | 280.32 |
| CAS Registry Number | 156900-92-4 |
| SMILES | CC3C(CC24C1(OC1)C(OCC2C(CC34)C(O)=O)=O)C |
| InChI | 1S/C15H20O5/c1-7-4-14-10(8(7)2)3-9(12(16)17)11(14)5-19-13(18)15(14)6-20-15/h7-11H,3-6H2,1-2H3,(H,16,17) |
| InChIKey | HXNTZKHPSFBXPN-UHFFFAOYSA-N |
| Density | 1.344g/cm3 (Cal.) |
|---|---|
| Boiling point | 491.902°C at 760 mmHg (Cal.) |
| Flash point | 186.941°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Tetrahydropentalenolactone |