Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 5,6,7,8-Tetrahydro-3,5,5,8,8-Pentamethyl-2-Naphthalenecarboxaldehyde |
|---|---|
| Synonyms | 1,1,4,4,7-Pentamethyltetralin-6-Carbaldehyde; 1,1,4,4,7-Pentamethyl-6-Tetralincarboxaldehyde; Nsc17410 |
| Molecular Structure |  |
| Molecular Formula | C16H22O |
| Molecular Weight | 230.35 |
| CAS Registry Number | 17610-20-7 |
| SMILES | C1=C2C(=CC(=C1C=O)C)C(CCC2(C)C)(C)C |
| InChI | 1S/C16H22O/c1-11-8-13-14(9-12(11)10-17)16(4,5)7-6-15(13,2)3/h8-10H,6-7H2,1-5H3 |
| InChIKey | JEJZFUVABODMHT-UHFFFAOYSA-N |
| Density | 0.956g/cm3 (Cal.) |
|---|---|
| Boiling point | 324.026°C at 760 mmHg (Cal.) |
| Flash point | 120.844°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5,6,7,8-Tetrahydro-3,5,5,8,8-Pentamethyl-2-Naphthalenecarboxaldehyde |