Online Database of Chemicals from Around the World
|
CAS#: 15724-88-6 Product: (E)-4',beta-Dichloroacrylophenone No suppilers available for the product. |
| Name | (E)-4',beta-Dichloroacrylophenone |
|---|---|
| Synonyms | Acrylophenone, 3,4'-Dichloro-, (E)-; Trans-3,4'-Dichloroacrylophenone |
| Molecular Structure |  |
| Molecular Formula | C9H6Cl2O |
| Molecular Weight | 201.05 |
| CAS Registry Number | 15724-88-6 |
| SMILES | C1=C(C(\C=C\Cl)=O)C=CC(=C1)Cl |
| InChI | 1S/C9H6Cl2O/c10-6-5-9(12)7-1-3-8(11)4-2-7/h1-6H/b6-5+ |
| InChIKey | DSLXRANAPTYXPW-AATRIKPKSA-N |
| Density | 1.302g/cm3 (Cal.) |
|---|---|
| Boiling point | 279.833°C at 760 mmHg (Cal.) |
| Flash point | 116.456°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (E)-4',beta-Dichloroacrylophenone |