Online Database of Chemicals from Around the World
| Otava Ltd. | Ukraine | Inquire | ||
|---|---|---|---|---|
 |
+380 (44) 522-2458 | |||
 |
order@otavachemicals.com | |||
| Chemical manufacturer since 1997 | ||||
| Name | 2,8-Dichloro-1H-Adenine |
|---|---|
| Synonyms | (2,8-Dichloro-7H-Purin-6-Yl)Amine; 2,8-Dichloro-1H-Adenine |
| Molecular Structure |  |
| Molecular Formula | C5H3Cl2N5 |
| Molecular Weight | 204.02 |
| CAS Registry Number | 2914-09-2 |
| EINECS | 220-827-2 |
| SMILES | C2(=NC(=C1[NH]C(=NC1=N2)Cl)N)Cl |
| InChI | 1S/C5H3Cl2N5/c6-4-9-1-2(8)10-5(7)12-3(1)11-4/h(H3,8,9,10,11,12) |
| InChIKey | KTWHRTDJQIMWMY-UHFFFAOYSA-N |
| Density | 1.894g/cm3 (Cal.) |
|---|---|
| Boiling point | 378.759°C at 760 mmHg (Cal.) |
| Flash point | 182.867°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,8-Dichloro-1H-Adenine |