|
CAS#: 15725-05-0 Product: (3,4,5,6-Tetrachloro-1,2-Phenylene)Bis(Trimethylstannane) No suppilers available for the product. |
| Name | (3,4,5,6-Tetrachloro-1,2-Phenylene)Bis(Trimethylstannane) |
|---|---|
| Synonyms | Stannane, (3,4,5,6-tetrachloro-o-phenylene)bis-, trimethyl-; Stannane, (3,4,5,6-tetrachloro-o-phenylene)bis[trimethyl-; Trimethyl |
| Molecular Structure | ![]() |
| Molecular Formula | C12H18Cl4Sn2 |
| Molecular Weight | 541.50 |
| CAS Registry Number | 15725-05-0 |
| SMILES | Clc1c(c(c(Cl)c(Cl)c1Cl)[Sn](C)(C)C)[Sn](C)(C)C |
| InChI | 1S/C6Cl4.6CH3.2Sn/c7-3-1-2-4(8)6(10)5(3)9;;;;;;;;/h;6*1H3;; |
| InChIKey | JHEQOVGZJIGKOC-UHFFFAOYSA-N |
| Boiling point | 414.873°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 204.708°C (Cal.) |
| Refractive index | (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (3,4,5,6-Tetrachloro-1,2-Phenylene)Bis(Trimethylstannane) |