|
CAS#: 86335-26-4 Product: [2-(2,3,5,6-Tetrachlorophenoxy)phenyl]acetic acid No suppilers available for the product. |
| Name | [2-(2,3,5,6-Tetrachlorophenoxy)phenyl]acetic acid |
|---|---|
| Synonyms | (2-(2,3,5,6-Tetrachlorophenoxy)phenyl)acetic acid; [2-(2,3,5,6-Tetrachloro-phenoxy)-phenyl]-acetic acid; Acetic acid, (2-(2,3,5,6-tetrachlorophenoxy)phenyl)- |
| Molecular Structure | ![]() |
| Molecular Formula | C14H8Cl4O3 |
| Molecular Weight | 366.02 |
| CAS Registry Number | 86335-26-4 |
| SMILES | C1=CC=C(C(=C1)CC(=O)O)OC2=C(C(=CC(=C2Cl)Cl)Cl)Cl |
| InChI | 1S/C14H8Cl4O3/c15-8-6-9(16)13(18)14(12(8)17)21-10-4-2-1-3-7(10)5-11(19)20/h1-4,6H,5H2,(H,19,20) |
| InChIKey | GHGPBRILEYTPSN-UHFFFAOYSA-N |
| Density | 1.6±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 439.2±45.0°C at 760 mmHg (Cal.) |
| Flash point | 219.4±28.7°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for [2-(2,3,5,6-Tetrachlorophenoxy)phenyl]acetic acid |