Online Database of Chemicals from Around the World
|
CAS#: 15811-52-6 Product: 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,12,12,12-Docosafluoro-11-(Trifluoromethyl)Dodecanoyl Fluoride No suppilers available for the product. |
| Name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,12,12,12-Docosafluoro-11-(Trifluoromethyl)Dodecanoyl Fluoride |
|---|---|
| Synonyms | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,12,12,12-Docosafluoro-11-(Trifluoromethyl)Lauryl Fluoride; Dodecanoyl Fluoride, Docosafluoro-11-(Trifluoromethyl)- |
| Molecular Structure |  |
| Molecular Formula | C13F26O |
| Molecular Weight | 666.10 |
| CAS Registry Number | 15811-52-6 |
| EINECS | 239-909-4 |
| SMILES | O=C(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(C(F)(F)F)C(F)(F)F |
| InChI | 1S/C13F26O/c14-1(40)2(15,16)4(18,19)6(22,23)8(26,27)10(30,31)11(32,33)9(28,29)7(24,25)5(20,21)3(17,12(34,35)36)13(37,38)39 |
| InChIKey | KRIKPLSQWRBSRS-UHFFFAOYSA-N |
| Density | 1.742g/cm3 (Cal.) |
|---|---|
| Boiling point | 210.87°C at 760 mmHg (Cal.) |
| Flash point | 78.899°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,12,12,12-Docosafluoro-11-(Trifluoromethyl)Dodecanoyl Fluoride |