Online Database of Chemicals from Around the World
|
CAS#: 16486-96-7 Product: Docosafluoro-11-(Trifluoromethyl)Dodecanoic Acid No suppilers available for the product. |
| Name | Docosafluoro-11-(Trifluoromethyl)Dodecanoic Acid |
|---|---|
| Synonyms | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,12,12,12-Docosafluoro-11-(Trifluoromethyl)Lauric Acid; Docosafluoro-11-(Trifluoromethyl)Dodecanoic Acid; Dodecanoic Acid, Docosafluoro-11-(Trifluoromethyl)- |
| Molecular Structure |  |
| Molecular Formula | C13HF25O2 |
| Molecular Weight | 664.11 |
| CAS Registry Number | 16486-96-7 |
| EINECS | 240-545-3 |
| SMILES | O=C(C(C(C(C(C(C(C(C(C(C(C(F)(F)F)(F)C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)O |
| InChI | 1S/C13HF25O2/c14-2(15,1(39)40)4(17,18)6(21,22)8(25,26)10(29,30)11(31,32)9(27,28)7(23,24)5(19,20)3(16,12(33,34)35)13(36,37)38/h(H,39,40) |
| InChIKey | CQXLVCXAWBBSDD-UHFFFAOYSA-N |
| Density | 1.773g/cm3 (Cal.) |
|---|---|
| Boiling point | 253.459°C at 760 mmHg (Cal.) |
| Flash point | 107.088°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Docosafluoro-11-(Trifluoromethyl)Dodecanoic Acid |