Online Database of Chemicals from Around the World
|
CAS#: 15817-15-9 Product: Allyl 3-Phenyloxirane-2-Carboxylate No suppilers available for the product. |
| Name | Allyl 3-Phenyloxirane-2-Carboxylate |
|---|---|
| Synonyms | Allyl 3-Phenyloxirane-2-Carboxylate; 3-Phenyl-2-Oxiranecarboxylic Acid Allyl Ester; 3-Phenyloxirane-2-Carboxylic Acid Allyl Ester |
| Molecular Structure |  |
| Molecular Formula | C12H12O3 |
| Molecular Weight | 204.23 |
| CAS Registry Number | 15817-15-9 |
| EINECS | 239-915-7 |
| SMILES | C2=C(C1C(O1)C(=O)OCC=C)C=CC=C2 |
| InChI | 1S/C12H12O3/c1-2-8-14-12(13)11-10(15-11)9-6-4-3-5-7-9/h2-7,10-11H,1,8H2 |
| InChIKey | GOGSOMHYWHWPJL-UHFFFAOYSA-N |
| Density | 1.172g/cm3 (Cal.) |
|---|---|
| Boiling point | 298.742°C at 760 mmHg (Cal.) |
| Flash point | 121.296°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Allyl 3-Phenyloxirane-2-Carboxylate |