|
CAS#: 204587-86-0 Product: (R)-(+)-N-Allyl-1-Phenylethylamine Hydrochloride No suppilers available for the product. |
| Name | (R)-(+)-N-Allyl-1-Phenylethylamine Hydrochloride |
|---|---|
| Synonyms | Allyl-[(1R)-1-Phenylethyl]Ammonium; [(1R)-1-Phenylethyl]-Prop-2-Enyl-Azanium; Zinc02386537 |
| Molecular Structure | ![]() |
| Molecular Formula | C11H16N |
| Molecular Weight | 162.25 |
| CAS Registry Number | 204587-86-0 |
| SMILES | [C@H]([NH2+]CC=C)(C1=CC=CC=C1)C |
| InChI | 1S/C11H15N/c1-3-9-12-10(2)11-7-5-4-6-8-11/h3-8,10,12H,1,9H2,2H3/p+1/t10-/m1/s1 |
| InChIKey | GGNXWCWCESEPFK-SNVBAGLBSA-O |
| Boiling point | 225.628°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 89.408°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for (R)-(+)-N-Allyl-1-Phenylethylamine Hydrochloride |