| Acesys Pharmatech | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (800) 792-0471 / (908) 998-1240 | |||
![]() |
info@acesyspharma.com, | |||
| Chemical manufacturer | ||||
| OX CHEM | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (626) 461-2812 | |||
![]() |
sales@ox-chem.com | |||
| CRO since 2013 | ||||
| SL Drugs and Pharmaceuticals Pvt. Ltd. | India | Inquire | ||
|---|---|---|---|---|
![]() |
+91 (40) 6661-1133 | |||
![]() |
enquiry@sldrugs.com | |||
| Chemical distributor since 1999 | ||||
| Zylexa Pharma Ltd. | UK | Inquire | ||
|---|---|---|---|---|
![]() |
+44 (845) 299-6009/ | |||
![]() |
sales@zylexa-pharma.com,enquiries@zylexa-pharma.com | |||
| Chemical manufacturer | ||||
| Name | N-(6-Bromo-1-Oxo-2,3-Dihydro-1H-Inden-5-Yl)Acetamide |
|---|---|
| Synonyms | 5-Acetamido-6-bromoindan-1-one; MFCD09263982; N-(6-Bromo-1-oxo-2,3-dihydro-1H-inden-5-yl)acetamide |
| Molecular Formula | C11H10BrNO2 |
| Molecular Weight | 268.11 |
| CAS Registry Number | 158205-18-6 |
| SMILES | CC(=O)NC1=C(C=C2C(=C1)CCC2=O)Br |
| InChI | 1S/C11H10BrNO2/c1-6(14)13-10-4-7-2-3-11(15)8(7)5-9(10)12/h4-5H,2-3H2,1H3,(H,13,14) |
| InChIKey | YHERMLQVYMECSV-UHFFFAOYSA-N |
| Density | 1.6±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 458.5±45.0°C at 760 mmHg (Cal.) |
| Flash point | 231.1±28.7°C (Cal.) |
| Refractive index | 1.658 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-(6-Bromo-1-Oxo-2,3-Dihydro-1H-Inden-5-Yl)Acetamide |