| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Sigma-Aldrich, Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+86 (21) 6141-5566 / 800-819-3336 | |||
![]() |
ordercn@sial.com, | |||
| Chemical manufacturer since 1992 | ||||
| Name | 3,3'-[(2-Oxo-1,3-Dithiole-4,5-Diyl)Disulfanediyl]Dipropanenitrile |
|---|---|
| Synonyms | 3,3'-(2-o |
| Molecular Structure | ![]() |
| Molecular Formula | C9H8N2OS4 |
| Molecular Weight | 288.43 |
| CAS Registry Number | 158871-28-4 |
| SMILES | O=C1SC(/SCCC#N)=C(/SCCC#N)S1 |
| InChI | 1S/C9H8N2OS4/c10-3-1-5-13-7-8(14-6-2-4-11)16-9(12)15-7/h1-2,5-6H2 |
| InChIKey | SIYHFUIJFJOCQE-UHFFFAOYSA-N |
| Density | 1.496g/cm3 (Cal.) |
|---|---|
| Melting point | 84°C (Expl.) |
| Boiling point | 511.555°C at 760 mmHg (Cal.) |
| Flash point | 263.179°C (Cal.) |
| Refractive index | 1.684 (Cal.) |
| SDS | Available |
|---|---|
| (1) | G.-Q. Liu, W.-T. Yu, G. Xue, Z. Liu and Q. Fang. 4,5-Bis(2-cyanoethylthio)-1,3-dithiol-2-one, Acta Cryst. (2002). E58, o514-o516 |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 3,3'-[(2-Oxo-1,3-Dithiole-4,5-Diyl)Disulfanediyl]Dipropanenitrile |