|
CAS#: 64394-47-4 Product: 5-(5-Oxo[1,3]dithiolo[4,5-d][1,3]dithiol-2-ylidene)[1,3]dithiolo[4,5-d][1,3]dithiol-2-one No suppilers available for the product. |
| Name | 5-(5-Oxo[1,3]dithiolo[4,5-d][1,3]dithiol-2-ylidene)[1,3]dithiolo[4,5-d][1,3]dithiol-2-one |
|---|---|
| Synonyms | Bis(carbonyldithio)tetrathiafulvalene |
| Molecular Structure | ![]() |
| Molecular Formula | C8O2S8 |
| Molecular Weight | 384.60 |
| CAS Registry Number | 64394-47-4 |
| SMILES | O=C1SC=2SC(\SC=2S1)=C3\SC=4SC(=O)SC=4S3 |
| InChI | 1S/C8O2S8/c9-7-15-3-4(16-7)12-1(11-3)2-13-5-6(14-2)18-8(10)17-5 |
| InChIKey | JVSSQMMIVZRMMO-UHFFFAOYSA-N |
| Density | 2.243g/cm3 (Cal.) |
|---|---|
| Boiling point | 534.017°C at 760 mmHg (Cal.) |
| Flash point | 244.097°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 5-(5-Oxo[1,3]dithiolo[4,5-d][1,3]dithiol-2-ylidene)[1,3]dithiolo[4,5-d][1,3]dithiol-2-one |