Online Database of Chemicals from Around the World
|
CAS#: 15894-29-8 Product: 1-{[(Dichloromethyl)Sulfonyl]Methyl}-3-(Trifluoromethyl)Benzene No suppilers available for the product. |
| Name | 1-{[(Dichloromethyl)Sulfonyl]Methyl}-3-(Trifluoromethyl)Benzene |
|---|---|
| Synonyms | Dichloromethyl 3-(trifluoromethyl)benzyl sulfone # |
| Molecular Structure | ![CAS#: 15894-29-8， 1-{[(Dichloromethyl)Sulfonyl]Methyl}-3-(Trifluoromethyl)Benzene](/moreStructures/15894-29-8.gif) |
| Molecular Formula | C9H7Cl2F3O2S |
| Molecular Weight | 307.12 |
| CAS Registry Number | 15894-29-8 |
| SMILES | FC(F)(F)c1cccc(c1)CS(=O)(=O)C(Cl)Cl |
| InChI | 1S/C9H7Cl2F3O2S/c10-8(11)17(15,16)5-6-2-1-3-7(4-6)9(12,13)14/h1-4,8H,5H2 |
| InChIKey | KDGCYXWTYONMAN-UHFFFAOYSA-N |
| Density | 1.536g/cm3 (Cal.) |
|---|---|
| Boiling point | 372.315°C at 760 mmHg (Cal.) |
| Flash point | 178.97°C (Cal.) |
| Refractive index | 1.507 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-{[(Dichloromethyl)Sulfonyl]Methyl}-3-(Trifluoromethyl)Benzene |