Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | Dichloromethyl(1,1,2,2-Tetrafluoroethyl)Silane |
|---|---|
| Synonyms | 1,1,2,2-Tetrafluoroethylmethyldichlorosilane; Dichloromethyl(1,1,2,2-Tetrafluoroethyl)Silane |
| Molecular Structure |  |
| Molecular Formula | C3H4Cl2F4Si |
| Molecular Weight | 215.05 |
| CAS Registry Number | 422-69-5 |
| EINECS | 207-022-1 |
| SMILES | C[Si](C(C(F)F)(F)F)(Cl)Cl |
| InChI | 1S/C3H4Cl2F4Si/c1-10(4,5)3(8,9)2(6)7/h2H,1H3 |
| InChIKey | DNTIELRTZGGEAE-UHFFFAOYSA-N |
| Density | 1.354g/cm3 (Cal.) |
|---|---|
| Boiling point | 83.337°C at 760 mmHg (Cal.) |
| Flash point | 4.202°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Dichloromethyl(1,1,2,2-Tetrafluoroethyl)Silane |