Online Database of Chemicals from Around the World
| Classification | Chemical reagent >> Organic reagent >> Thiourea |
|---|---|
| Name | 1-Phenyl-3-Guanylthiourea |
| Synonyms | 1-(Diaminomethylene)-3-Phenyl-Thiourea; 1-(Diaminomethylene)-3-Phenylthiourea; 1-(Diaminomethylidene)-3-Phenyl-Thiourea |
| Molecular Structure |  |
| Molecular Formula | C8H10N4S |
| Molecular Weight | 194.25 |
| CAS Registry Number | 15989-47-6 |
| SMILES | C1=C(NC(=S)N=C(N)N)C=CC=C1 |
| InChI | 1S/C8H10N4S/c9-7(10)12-8(13)11-6-4-2-1-3-5-6/h1-5H,(H5,9,10,11,12,13) |
| InChIKey | IKGVILAOZDBXSV-UHFFFAOYSA-N |
| Density | 1.344g/cm3 (Cal.) |
|---|---|
| Melting point | 169°C (Expl.) |
| Boiling point | 364.155°C at 760 mmHg (Cal.) |
| Flash point | 174.035°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 1-Phenyl-3-Guanylthiourea |
