Online Database of Chemicals from Around the World
| ChemBridge Corporation | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (858) 451-7400 | |||
 |
sales@chembridge.com | |||
| Chemical manufacturer | ||||
| Name | N(2)-Phenylguanine |
|---|---|
| Synonyms | Zinc01514736; 1,7-Dihydro-2-(Phenylamino)-6H-Purin-6-One; N(2)-Phenylguanine |
| Molecular Structure |  |
| Molecular Formula | C11H9N5O |
| Molecular Weight | 227.23 |
| CAS Registry Number | 40769-49-1 |
| SMILES | C1=NC2=C([NH]1)C(=O)N=C(N2)NC3=CC=CC=C3 |
| InChI | 1S/C11H9N5O/c17-10-8-9(13-6-12-8)15-11(16-10)14-7-4-2-1-3-5-7/h1-6H,(H3,12,13,14,15,16,17) |
| InChIKey | JDCULXHGRMPCAM-UHFFFAOYSA-N |
| Density | 1.567g/cm3 (Cal.) |
|---|---|
| Boiling point | 538.95°C at 760 mmHg (Cal.) |
| Flash point | 279.747°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N(2)-Phenylguanine |