Online Database of Chemicals from Around the World
| Carbosynth China Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 (512) 6260-5585 | |||
 |
sales@carbosynth.com | |||
 |
QQ Chat | |||
| Chemical manufacturer since 2006 Chemical distributor since 2006 | ||||
| chemBlink standard supplier since 2016 | ||||
| Paragos e. K. | Germany | Inquire | ||
|---|---|---|---|---|
|
+49 2330-8079751 | |||
|
sales@paragos.de | |||
| Chemical manufacturer since 2001 | ||||
| Name | (2R,3R,4S,5S)-6-(Acetoxymethyl)-2-Bromo-2-Carbamoyltetrahydro-2H-Pyran-3,4,5-Triyl Triacetate |
|---|---|
| Synonyms | C-(2,3,4,6-Tetra-O-acetyl-1-bromo-1-deoxy-ß-D-gala |
| Molecular Structure |  |
| Molecular Formula | C15H20BrNO10 |
| Molecular Weight | 454.22 |
| CAS Registry Number | 159895-07-5 |
| SMILES | CC(=O)OCC1[C@@H]([C@@H]([C@H]([C@](O1)(C(=O)N)Br)OC(=O)C)OC(=O)C)OC(=O)C |
| InChI | 1S/C15H20BrNO10/c1-6(18)23-5-10-11(24-7(2)19)12(25-8(3)20)13(26-9(4)21)15(16,27-10)14(17)22/h10-13H,5H2,1-4H3,(H2,17,22)/t10?,11-,12-,13+,15-/m0/s1 |
| InChIKey | OFBIPUGROIRDQG-QFZUJPIRSA-N |
| Density | 1.6±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 513.9±50.0°C at 760 mmHg (Cal.) |
| Flash point | 264.6±30.1°C (Cal.) |
| Refractive index | 1.528 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2R,3R,4S,5S)-6-(Acetoxymethyl)-2-Bromo-2-Carbamoyltetrahydro-2H-Pyran-3,4,5-Triyl Triacetate |