Online Database of Chemicals from Around the World
|
CAS#: 42978-43-8 Product: 6-Acetoxymethylbenzo(a)Pyrene No suppilers available for the product. |
| Name | 6-Acetoxymethylbenzo(a)Pyrene |
|---|---|
| Synonyms | Acetic Acid 6-Benzo[B]Pyrenylmethyl Ester; Acetic Acid Benzo[B]Pyren-6-Ylmethyl Ester; Benzo[B]Pyren-6-Ylmethyl Ethanoate |
| Molecular Structure |  |
| Molecular Formula | C23H16O2 |
| Molecular Weight | 324.38 |
| CAS Registry Number | 42978-43-8 |
| SMILES | C1=CC4=C3C2=C1C5=C(C(=C2C=CC3=CC=C4)COC(C)=O)C=CC=C5 |
| InChI | 1S/C23H16O2/c1-14(24)25-13-21-18-8-3-2-7-17(18)19-11-9-15-5-4-6-16-10-12-20(21)23(19)22(15)16/h2-12H,13H2,1H3 |
| InChIKey | AIXMKWLMVGVTGG-UHFFFAOYSA-N |
| Density | 1.303g/cm3 (Cal.) |
|---|---|
| Boiling point | 527.839°C at 760 mmHg (Cal.) |
| Flash point | 211.134°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-Acetoxymethylbenzo(a)Pyrene |