Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | Biphenyl-2,4-Ylenediamine |
|---|---|
| Synonyms | (5-Amino-2-Phenyl-Phenyl)Amine; Biphenyl-2,4-Ylenediamine |
| Molecular Structure |  |
| Molecular Formula | C12H12N2 |
| Molecular Weight | 184.24 |
| CAS Registry Number | 16069-32-2 |
| EINECS | 240-215-9 |
| SMILES | C1=CC(=CC(=C1C2=CC=CC=C2)N)N |
| InChI | 1S/C12H12N2/c13-10-6-7-11(12(14)8-10)9-4-2-1-3-5-9/h1-8H,13-14H2 |
| InChIKey | AXTSDCSKRWMCRQ-UHFFFAOYSA-N |
| Density | 1.157g/cm3 (Cal.) |
|---|---|
| Boiling point | 356.83°C at 760 mmHg (Cal.) |
| Flash point | 202.079°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Biphenyl-2,4-Ylenediamine |