|
CAS#: 51097-86-0 Product: alpha-(4-Biphenylyl)-alpha-Ethyl-1-Piperidinepropanol Hydrochloride No suppilers available for the product. |
| Name | alpha-(4-Biphenylyl)-alpha-Ethyl-1-Piperidinepropanol Hydrochloride |
|---|---|
| Synonyms | 3-(4-Phenylphenyl)-1-(1-Piperidyl)Pentan-3-Ol Hydrochloride; 3-(4-Phenylphenyl)-1-Piperidino-Pentan-3-Ol Hydrochloride; 3-(4-Phenylphenyl)-1-Piperidin-1-Yl-Pentan-3-Ol Hydrochloride |
| Molecular Structure | ![]() |
| Molecular Formula | C22H30ClNO |
| Molecular Weight | 359.94 |
| CAS Registry Number | 51097-86-0 |
| SMILES | [H+].C2=C(C(O)(CCN1CCCCC1)CC)C=CC(=C2)C3=CC=CC=C3.[Cl-] |
| InChI | 1S/C22H29NO.ClH/c1-2-22(24,15-18-23-16-7-4-8-17-23)21-13-11-20(12-14-21)19-9-5-3-6-10-19;/h3,5-6,9-14,24H,2,4,7-8,15-18H2,1H3;1H |
| InChIKey | ZHPTXEWUAPKDKF-UHFFFAOYSA-N |
| Boiling point | 490.3°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 241.4°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for alpha-(4-Biphenylyl)-alpha-Ethyl-1-Piperidinepropanol Hydrochloride |