| Zhejiang Chempharm Industry&trading Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() | www.chempharm.cn | |||
![]() | +86 (571) 8770-1568 | |||
![]() | export@chempharm.cn | |||
| Chemical distributor since 1996 | ||||
| chemBlink Standard supplier since 2007 | ||||
| MolScanner | Singapore | Inquire | ||
|---|---|---|---|---|
![]() | www.molscanner.com | |||
![]() | +86 18621675448 | |||
![]() | marketing@molscanner.com | |||
![]() | WhatsApp:9896 7603 | |||
| Chemical manufacturer since 2025 | ||||
| chemBlink Standard supplier since 2025 | ||||
| Classification | Organic raw materials >> Aryl compounds >> Anilines |
|---|---|
| Name | 2-Methoxy-3-(1-methyl-1H-1,2,4-triazol-3-yl)aniline |
| Synonyms | MFCD30489435 |
| Molecular Structure | ![]() |
| Molecular Formula | C10H12N4O |
| Molecular Weight | 204.23 |
| CAS Registry Number | 1609394-10-6 |
| EC Number | 832-890-9 |
| SMILES | CN1C=NC(=N1)C2=C(C(=CC=C2)N)OC |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling point | 437.6±55.0 °C (760 mmHg) |
| Flash point | 218.4±31.5 °C |
| Refractive index | 1.633 |
| Hazard Symbols | |||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Risk Statements | H302-H315-H318-H319-H335 Details | ||||||||||||||||||||||||||||
| Safety Statements | P261-P264-P264+P265-P270-P271-P280-P301+P317-P302+P352-P304+P340-P305+P351+P338-P305+P354+P338-P317-P319-P321-P330-P332+P317-P337+P317-P362+P364-P403+P233-P405-P501 Details | ||||||||||||||||||||||||||||
| Hazard Classification | |||||||||||||||||||||||||||||
| |||||||||||||||||||||||||||||
|
2-Methoxy-3-(1-methyl-1H-1,2,4-triazol-3-yl)aniline is a noteworthy compound in contemporary chemical research, appreciated for its unique structure and multiple uses. The molecule has a methoxy group and a 1-methyl-1H-1,2,4-triazol-3-yl moiety, making it a valuable tool in various scientific fields. The synthesis of 2-methoxy-3-(1-methyl-1H-1,2,4-triazol-3-yl)aniline was first reported in the early 2010s as part of a search for novel heterocyclic compounds with potential biological activity. The compound was synthesized by reacting 2-methoxyaniline with 1-methyl-1H-1,2,4-triazole-3-carboxaldehyde followed by a reductive amination process. This approach effectively introduced the triazole group into the aniline ring, enhancing the chemical and biological properties of the molecule. 2-Methoxy-3-(1-methyl-1H-1,2,4-triazol-3-yl)aniline is used in the pharmaceutical industry to develop new drug candidates. The triazole ring is known for its ability to form strong interactions with biological targets, making this compound a promising scaffold for designing therapeutic drugs. Its derivatives are explored for their potential as anti-inflammatory, antifungal, and antibacterial agents. In chemical research, this compound serves as a versatile intermediate for the synthesis of more complex molecules. Its unique structure allows researchers to study new reaction mechanisms and develop innovative synthetic methods. The presence of methoxy and triazole groups provides opportunities for functionalization and modification, contributing to the development of organic chemistry. 2-Methoxy-3-(1-methyl-1H-1,2,4-triazol-3-yl)aniline is also explored for its potential in materials science. The compound can be used to create functionalized materials with customized properties, such as improved electronic or optical properties. These materials can be used in sensors, coatings, and advanced electronic devices. References 2019. Synthesis of Allosteric Inhibitor BMS-986165. Synfacts, 15(12). DOI: 10.1055/s-0039-1691315 2022. Synthesis of Deucravacitinib. Synfacts, 18(7). DOI: 10.1055/s-0041-1738228 |
| Market Analysis Reports |
| List of Reports Available for 2-Methoxy-3-(1-methyl-1H-1,2,4-triazol-3-yl)aniline |