Online Database of Chemicals from Around the World
|
CAS#: 16339-28-9 Product: Dichloro-(Ethoxy)Borane No suppilers available for the product. |
| Name | Dichloro-(Ethoxy)Borane |
|---|---|
| Synonyms | Dichloro-Ethoxy-Borane; Dichloro-(Ethoxy)Borane; Inchi=1/C2h5bcl2o/C1-2-6-3(4)5/H2h2,1H |
| Molecular Structure |  |
| Molecular Formula | C2H5BCl2O |
| Molecular Weight | 126.78 |
| CAS Registry Number | 16339-28-9 |
| SMILES | C(OB(Cl)Cl)C |
| InChI | 1S/C2H5BCl2O/c1-2-6-3(4)5/h2H2,1H3 |
| InChIKey | CEUSKTVXHGPJDP-UHFFFAOYSA-N |
| Density | 1.126g/cm3 (Cal.) |
|---|---|
| Boiling point | 78.671°C at 760 mmHg (Cal.) |
| Flash point | 1.381°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Dichloro-(Ethoxy)Borane |