|
CAS#: 26424-27-1 Product: 2,4-Dichloro-6-(2-Ethoxyethoxy)-1,3,5-Triazine No suppilers available for the product. |
| Name | 2,4-Dichloro-6-(2-Ethoxyethoxy)-1,3,5-Triazine |
|---|---|
| Synonyms | 2,4-Dichloro-6-(2-Ethoxyethoxy)-S-Triazine |
| Molecular Structure | ![]() |
| Molecular Formula | C7H9Cl2N3O2 |
| Molecular Weight | 238.07 |
| CAS Registry Number | 26424-27-1 |
| EINECS | 247-687-5 |
| SMILES | C(OC1=NC(=NC(=N1)Cl)Cl)COCC |
| InChI | 1S/C7H9Cl2N3O2/c1-2-13-3-4-14-7-11-5(8)10-6(9)12-7/h2-4H2,1H3 |
| InChIKey | QCIAWGOXCYGJNS-UHFFFAOYSA-N |
| Density | 1.377g/cm3 (Cal.) |
|---|---|
| Boiling point | 382.331°C at 760 mmHg (Cal.) |
| Flash point | 185.027°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,4-Dichloro-6-(2-Ethoxyethoxy)-1,3,5-Triazine |