|
CAS#: 16394-71-1 Product: 16-alpha-Methylpregnenolone No suppilers available for the product. |
| Name | 16-alpha-Methylpregnenolone |
|---|---|
| Synonyms | 16.Alpha.-Methylpregnenolone; 3.Beta.-Hydroxy-16.Beta.-Methyl-5-Pregnen-20-One; Nsc75642 |
| Molecular Structure | ![]() |
| Molecular Formula | C22H34O2 |
| Molecular Weight | 330.51 |
| CAS Registry Number | 16394-71-1 |
| SMILES | [C@H]23[C@H]1[C@@]([C@H]([C@@H](C1)C)C(=O)C)(CC[C@@H]2[C@@]4(C(=CC3)C[C@@H](O)CC4)C)C |
| InChI | 1S/C22H34O2/c1-13-11-19-17-6-5-15-12-16(24)7-9-21(15,3)18(17)8-10-22(19,4)20(13)14(2)23/h5,13,16-20,24H,6-12H2,1-4H3/t13-,16+,17-,18+,19+,20-,21+,22+/m1/s1 |
| InChIKey | XXSFRYVGIQYVIQ-RDTLVLTASA-N |
| Density | 1.077g/cm3 (Cal.) |
|---|---|
| Boiling point | 450.145°C at 760 mmHg (Cal.) |
| Flash point | 191.766°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 16-alpha-Methylpregnenolone |