Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | (5alpha)-20-Methylpregnane |
|---|---|
| Synonyms | 20-METHYL-5α(H)-PREGNANE |
| Molecular Structure |  |
| Molecular Formula | C22H38 |
| Molecular Weight | 302.54 |
| CAS Registry Number | 5737-19-9 |
| SMILES | CC(C)[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CC[C@@H]4[C@@]3(CCCC4)C)C |
| InChI | 1S/C22H38/c1-15(2)18-10-11-19-17-9-8-16-7-5-6-13-21(16,3)20(17)12-14-22(18,19)4/h15-20H,5-14H2,1-4H3/t16-,17+,18-,19+,20+,21+,22-/m1/s1 |
| InChIKey | NWNSDNWCYSYUMD-MVSFUWRLSA-N |
| Density | 0.9±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 373.1±9.0°C at 760 mmHg (Cal.) |
| Flash point | 169.9±12.3°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (5alpha)-20-Methylpregnane |