|
CAS#: 16422-07-4 Product: ({N-[(2S)-2-Ammoniopropanoyl]-L-Alanyl}Amino)Acetate No suppilers available for the product. |
| Name | ({N-[(2S)-2-Ammoniopropanoyl]-L-Alanyl}Amino)Acetate |
|---|---|
| Synonyms | AAG; A-A-G; ala-ala-gly |
| Molecular Structure | ![]() |
| Molecular Formula | C8H15N3O4 |
| Molecular Weight | 217.22 |
| CAS Registry Number | 16422-07-4 |
| SMILES | [O-]C(=O)CNC(=O)[C@@H](NC(=O)[C@@H]([NH3+])C)C |
| InChI | 1S/C8H15N3O4/c1-4(9)7(14)11-5(2)8(15)10-3-6(12)13/h4-5H,3,9H2,1-2H3,(H,10,15)(H,11,14)(H,12,13)/t4-,5-/m0/s1 |
| InChIKey | RLMISHABBKUNFO-WHFBIAKZSA-N |
| Density | 1.266g/cm3 (Cal.) |
|---|---|
| Boiling point | 581.774°C at 760 mmHg (Cal.) |
| Flash point | 305.646°C (Cal.) |
| Refractive index | 1.51 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for ({N-[(2S)-2-Ammoniopropanoyl]-L-Alanyl}Amino)Acetate |