Online Database of Chemicals from Around the World
|
CAS#: 63589-20-8 Product: 2-Ammoniothiazolium Sulphate No suppilers available for the product. |
| Name | 2-Ammoniothiazolium Sulphate |
|---|---|
| Synonyms | Sulfuric Acid; Thiazol-2-Amine; Sulfuric Acid; 2-Thiazolamine; Sulfuric Acid; Thiazol-2-Ylamine |
| Molecular Structure |  |
| Molecular Formula | C3H6N2O4S2 |
| Molecular Weight | 198.21 |
| CAS Registry Number | 63589-20-8 |
| EINECS | 264-345-0 |
| SMILES | O=[S](=O)(O)O.C1=CN=C(S1)N |
| InChI | 1S/C3H4N2S.H2O4S/c4-3-5-1-2-6-3;1-5(2,3)4/h1-2H,(H2,4,5);(H2,1,2,3,4) |
| InChIKey | QOJSIZLNPFGXCS-UHFFFAOYSA-N |
| Boiling point | 216.4°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 84.7°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Ammoniothiazolium Sulphate |