Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | Diethyl (3-Chloroallyl)Phosphonate |
|---|---|
| Synonyms | (E)-1-Chloro-3-Diethoxyphosphorylprop-1-Ene; 1-Chloro-3-Diethoxyphosphoryl-Prop-1-Ene; (E)-1-Chloro-3-Diethoxyphosphoryl-Prop-1-Ene |
| Molecular Structure |  |
| Molecular Formula | C7H14ClO3P |
| Molecular Weight | 212.61 |
| CAS Registry Number | 16485-99-7 |
| EINECS | 240-542-7 |
| SMILES | C(O[P](OCC)(=O)C/C=C/Cl)C |
| InChI | 1S/C7H14ClO3P/c1-3-10-12(9,11-4-2)7-5-6-8/h5-6H,3-4,7H2,1-2H3/b6-5+ |
| InChIKey | XENNXUCIWBEUFL-AATRIKPKSA-N |
| Density | 1.143g/cm3 (Cal.) |
|---|---|
| Boiling point | 267.431°C at 760 mmHg (Cal.) |
| Flash point | 131.957°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Diethyl (3-Chloroallyl)Phosphonate |