Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | [1-(Phenylsulfonyl)-1H-Pyrrol-2-Yl]Boronic Acid |
|---|---|
| Synonyms | 1-(Phenylsulfonyl)-1H-pyrrol-2-ylboronic acid; 1-(PHENYLSULFONYL)PYRROLE-2-BORONIC ACID; BORONIC ACID,[1-(PHENYLSULFONYL)-1H-PYRROL-2-YL]- (9CI) |
| Molecular Structure | ![CAS#: 165071-70-5， [1-(Phenylsulfonyl)-1H-Pyrrol-2-Yl]Boronic Acid](/moreStructures/165071-70-5.gif) |
| Molecular Formula | C10H10BNO4S |
| Molecular Weight | 251.07 |
| CAS Registry Number | 165071-70-5 |
| SMILES | O=S(=O)(c1ccccc1)n2cccc2B(O)O |
| InChI | 1S/C10H10BNO4S/c13-11(14)10-7-4-8-12(10)17(15,16)9-5-2-1-3-6-9/h1-8,13-14H |
| InChIKey | YNZZJEOSBKZERV-UHFFFAOYSA-N |
| Density | 1.341g/cm3 (Cal.) |
|---|---|
| Boiling point | 513.604°C at 760 mmHg (Cal.) |
| Flash point | 264.419°C (Cal.) |
| Refractive index | 1.597 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for [1-(Phenylsulfonyl)-1H-Pyrrol-2-Yl]Boronic Acid |