|
CAS#: 947498-93-3 Product: 1-(Phenylsulfonyl)-1H-pyrrolo[2,3-b]pyridin-3-yl formate No suppilers available for the product. |
| Name | 1-(Phenylsulfonyl)-1H-pyrrolo[2,3-b]pyridin-3-yl formate |
|---|---|
| Synonyms | 1H-Pyrrol |
| Molecular Structure | ![]() |
| Molecular Formula | C14H10N2O4S |
| Molecular Weight | 302.31 |
| CAS Registry Number | 947498-93-3 |
| SMILES | c1ccc(cc1)S(=O)(=O)n2cc(c3c2nccc3)OC=O |
| InChI | 1S/C14H10N2O4S/c17-10-20-13-9-16(14-12(13)7-4-8-15-14)21(18,19)11-5-2-1-3-6-11/h1-10H |
| InChIKey | KXSYYBJAEPMXMS-UHFFFAOYSA-N |
| Density | 1.426g/cm3 (Cal.) |
|---|---|
| Boiling point | 516.983°C at 760 mmHg (Cal.) |
| Flash point | 266.462°C (Cal.) |
| Refractive index | 1.661 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(Phenylsulfonyl)-1H-pyrrolo[2,3-b]pyridin-3-yl formate |