| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| P and M Invest Ltd. | Russian Federation | Inquire | ||
|---|---|---|---|---|
![]() |
+7 (495) 135-6494 | |||
![]() |
sales@fluorine.ru | |||
| Chemical manufacturer | ||||
| Name | 1,1,1,2,2-Pentachloro-3,3,3-Trifluoro-Propane |
|---|---|
| Synonyms | 1,1,1,2,2-Pentachloro-3,3,3-Trifluoropropane (CFC-213Ab) 97%; Propane, 1,1,1,2,2-Pentachloro-3,3,3-Trifluoro-; 1,1,1-TRIFLUORO-2,2,3,3,3-PENTACHLORO-PROPANE |
| Molecular Structure | ![]() |
| Molecular Formula | C3Cl5F3 |
| Molecular Weight | 270.29 |
| CAS Registry Number | 1652-89-7 |
| SMILES | FC(C(C(Cl)(Cl)Cl)(Cl)Cl)(F)F |
| InChI | 1S/C3Cl5F3/c4-1(5,2(6,7)8)3(9,10)11 |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 1,1,1,2,2-Pentachloro-3,3,3-Trifluoro-Propane |