Online Database of Chemicals from Around the World
|
CAS#: 6928-57-0 Product: 1,2,3,4,5-Pentachloro-5-(Trichloromethyl)Cyclopenta-1,3-Diene No suppilers available for the product. |
| Name | 1,2,3,4,5-Pentachloro-5-(Trichloromethyl)Cyclopenta-1,3-Diene |
|---|---|
| Synonyms | 1,3-Cyclopentadiene, 1,2,3,4,5-Pentachloro-5-(Trichloromethyl)-; Cyclopentadiene, 1,2,3,4,5-Pentachloro-5-(Trichloromethyl)-; Nsc407998 |
| Molecular Structure |  |
| Molecular Formula | C6Cl8 |
| Molecular Weight | 355.69 |
| CAS Registry Number | 6928-57-0 |
| SMILES | C1(=C(Cl)C(=C(Cl)C1(Cl)C(Cl)(Cl)Cl)Cl)Cl |
| InChI | 1S/C6Cl8/c7-1-2(8)4(10)5(11,3(1)9)6(12,13)14 |
| InChIKey | RCESHJJQJXYAIU-UHFFFAOYSA-N |
| Density | 1.883g/cm3 (Cal.) |
|---|---|
| Boiling point | 335.526°C at 760 mmHg (Cal.) |
| Flash point | 157.097°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2,3,4,5-Pentachloro-5-(Trichloromethyl)Cyclopenta-1,3-Diene |