Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 1-Oxa-3-Azaspiro[5.5]Undecane-2,7-Dione |
|---|---|
| Synonyms | 1-OXA-3-AZASPIRO[5.5]UNDECANE-2,7-DIONE |
| Molecular Structure | ![CAS#: 165683-59-0， 1-Oxa-3-Azaspiro[5.5]Undecane-2,7-Dione](/moreStructures/165683-59-0.gif) |
| Molecular Formula | C9H13NO3 |
| Molecular Weight | 183.20 |
| CAS Registry Number | 165683-59-0 |
| SMILES | C1CCC2(CCNC(=O)O2)C(=O)C1 |
| InChI | 1S/C9H13NO3/c11-7-3-1-2-4-9(7)5-6-10-8(12)13-9/h1-6H2,(H,10,12) |
| InChIKey | YLZMAWLSABHQDE-UHFFFAOYSA-N |
| Density | 1.232g/cm3 (Cal.) |
|---|---|
| Boiling point | 451.692°C at 760 mmHg (Cal.) |
| Flash point | 226.975°C (Cal.) |
| Refractive index | 1.521 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Oxa-3-Azaspiro[5.5]Undecane-2,7-Dione |