Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 11-Oxa-4-azatetracyclo[5.3.1.01,7.03,5]undeca-2,5,8-triene |
|---|---|
| Synonyms | 1,3-dihydro-2a,5a-epoxyindeno[5,6-b]azirine |
| Molecular Structure | ![CAS#: 880490-32-4， 11-Oxa-4-azatetracyclo[5.3.1.0<sup>1,7</sup>.0<sup>3,5</sup>]undeca-2,5,8-triene](/moreStructures/880490-32-4.gif) |
| Molecular Formula | C9H7NO |
| Molecular Weight | 145.16 |
| CAS Registry Number | 880490-32-4 |
| SMILES | C1C=CC23C1(O2)C=C4C(=C3)N4 |
| InChI | 1S/C9H7NO/c1-2-8-4-6-7(10-6)5-9(8,3-1)11-8/h1-2,4-5,10H,3H2 |
| InChIKey | XGTVAZZQOBIFOK-UHFFFAOYSA-N |
| Density | 1.497g/cm3 (Cal.) |
|---|---|
| Boiling point | 408.105°C at 760 mmHg (Cal.) |
| Flash point | 145.535°C (Cal.) |
| Refractive index | 1.769 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 11-Oxa-4-azatetracyclo[5.3.1.01,7.03,5]undeca-2,5,8-triene |