|
CAS#: 16596-00-2 Product: N,N'-Bis-(3-Chlorophenyl)Methanimidamide No suppilers available for the product. |
| Name | N,N'-Bis-(3-Chlorophenyl)Methanimidamide |
|---|---|
| Synonyms | N,N'-Bis(3-Chlorophenyl)Formamidine; N,N'-Bis-(3-Chlorophenyl)Formamidine; Nsc506344 |
| Molecular Structure | ![]() |
| Molecular Formula | C13H10Cl2N2 |
| Molecular Weight | 265.14 |
| CAS Registry Number | 16596-00-2 |
| SMILES | C1=C(C=C(C=C1)Cl)N=CNC2=CC(=CC=C2)Cl |
| InChI | 1S/C13H10Cl2N2/c14-10-3-1-5-12(7-10)16-9-17-13-6-2-4-11(15)8-13/h1-9H,(H,16,17) |
| InChIKey | ANZFKYAQFSGBES-UHFFFAOYSA-N |
| Density | 1.245g/cm3 (Cal.) |
|---|---|
| Boiling point | 388.695°C at 760 mmHg (Cal.) |
| Flash point | 188.876°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N,N'-Bis-(3-Chlorophenyl)Methanimidamide |