|
CAS#: 953-14-0 Product: 1,2-Bis(4-chlorophenyl)hydrazine No suppilers available for the product. |
| Name | 1,2-Bis(4-chlorophenyl)hydrazine |
|---|---|
| Synonyms | Nciopen2_004824; Nsc86541 |
| Molecular Formula | C12H10Cl2N2 |
| Molecular Weight | 253.13 |
| CAS Registry Number | 953-14-0 |
| SMILES | C1=CC(=CC=C1NNC2=CC=C(Cl)C=C2)Cl |
| InChI | 1S/C12H10Cl2N2/c13-9-1-5-11(6-2-9)15-16-12-7-3-10(14)4-8-12/h1-8,15-16H |
| InChIKey | BVPHWSDABGXRQD-UHFFFAOYSA-N |
| Density | 1.405g/cm3 (Cal.) |
|---|---|
| Boiling point | 288.563°C at 760 mmHg (Cal.) |
| Flash point | 128.319°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 1,2-Bis(4-chlorophenyl)hydrazine |