Online Database of Chemicals from Around the World
|
CAS#: 16757-80-5 Product: 11-Methylbenzo[a]Pyrene No suppilers available for the product. |
| Name | 11-Methylbenzo[a]Pyrene |
|---|---|
| Synonyms | Brn 2109259; Ccris 2444; 11-Methylbenzo(A)Pyrene |
| Molecular Structure | ![CAS#: 16757-80-5， 11-Methylbenzo[a]Pyrene](/moreStructures/16757-80-5.gif) |
| Molecular Formula | C21H14 |
| Molecular Weight | 266.34 |
| CAS Registry Number | 16757-80-5 |
| SMILES | C1=C5C3=C(C2=C1C=CC=C2)C(=CC4=C3C(=CC=C4)C=C5)C |
| InChI | 1S/C21H14/c1-13-11-16-7-4-6-14-9-10-17-12-15-5-2-3-8-18(15)19(13)21(17)20(14)16/h2-12H,1H3 |
| InChIKey | ZWJRHJOLMBZEMI-UHFFFAOYSA-N |
| Density | 1.254g/cm3 (Cal.) |
|---|---|
| Boiling point | 479.361°C at 760 mmHg (Cal.) |
| Flash point | 236.729°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 11-Methylbenzo[a]Pyrene |