Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 6-Methyl-Benzo[a]Pyrene |
|---|---|
| Synonyms | 3-05-00-02529 (Beilstein Handbook Reference); 5-Methyl-3,4-Benzopyrene; 5-Methyl-3,4-Benzpyrene |
| Molecular Structure | ![CAS#: 2381-39-7， 6-Methyl-Benzo[a]Pyrene](/moreStructures/2381-39-7.gif) |
| Molecular Formula | C21H14 |
| Molecular Weight | 266.34 |
| CAS Registry Number | 2381-39-7 |
| EINECS | 219-179-3 |
| SMILES | C2=CC1=CC=CC5=C1C3=C(C(=C4C(=C23)C=CC=C4)C)C=C5 |
| InChI | 1S/C21H14/c1-13-16-7-2-3-8-18(16)19-12-10-15-6-4-5-14-9-11-17(13)21(19)20(14)15/h2-12H,1H3 |
| InChIKey | YFYHJNJCAGHSFA-UHFFFAOYSA-N |
| Density | 1.254g/cm3 (Cal.) |
|---|---|
| Boiling point | 479.361°C at 760 mmHg (Cal.) |
| Flash point | 236.729°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-Methyl-Benzo[a]Pyrene |