Online Database of Chemicals from Around the World
|
CAS#: 16812-43-4 Product: Trimethyl-(Trimethylstannylmethyl)Stannane No suppilers available for the product. |
| Name | Trimethyl-(Trimethylstannylmethyl)Stannane |
|---|---|
| Synonyms | Bis(Trimethylstannyl)Methane; Nsc227331; Stannane, Methylenebis[Trimethyl- |
| Molecular Structure |  |
| Molecular Weight | 341.62 |
| CAS Registry Number | 16812-43-4 |
| SMILES | C([Sn](C)(C)C)[Sn](C)(C)C |
| InChI | 1S/6CH3.CH2.2Sn/h6*1H3;1H2;; |
| InChIKey | UCWABCCLELENRN-UHFFFAOYSA-N |
| Boiling point | 208.67°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 78.765°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Trimethyl-(Trimethylstannylmethyl)Stannane |