| Qingdao Haisu New Material Technology Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() | haisu6688.goldsupplier.com | |||
![]() | +86 13184133710 | |||
![]() | +86 (0532) 8090-9168 | |||
![]() | alice-haisu@outlook.com | |||
![]() | QQ Chat | |||
![]() | WeChat: 13184133710 | |||
![]() | WhatsApp:13184133710 | |||
| Chemical manufacturer since 2022 | ||||
| chemBlink Standard supplier since 2024 | ||||
| Classification | Organic raw materials >> Organosilicon compound |
|---|---|
| Name | 1,1,1-Trimethyl-N-(trimethylsilyl)silanamine - dioxosilane (1:1) |
| Synonyms | [dimethyl-(trimethylsilylamino)silyl]methane dioxosilane |
| Molecular Structure | ![]() |
| Molecular Formula | C6H19NO2Si3 |
| Molecular Weight | 221.48 |
| CAS Registry Number | 68909-20-6 |
| EC Number | 272-697-1 |
| SMILES | C[Si](C)(C)N[Si](C)(C)C.O=[Si]=O |
| Hazard Symbols | |||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Risk Statements | H315-H319-H373 Details | ||||||||||||||||||||||||
| Safety Statements | P260-P264-P264+P265-P280-P302+P352-P305+P351+P338-P319-P321-P332+P317-P337+P317-P362+P364-P501 Details | ||||||||||||||||||||||||
| Hazard Classification | |||||||||||||||||||||||||
| |||||||||||||||||||||||||
|
1,1,1-Trimethyl-N-(trimethylsilyl)silanamine - dioxosilane (1:1) is a notable compound in the field of organosilicon chemistry, recognized for its unique structural and chemical properties. This substance is often abbreviated as TMTD, and it consists of a combination of trimethylsilyl groups and silanamine functionalities, along with dioxosilane components. Its synthesis and applications have been subjects of considerable interest due to its versatility and reactivity. The discovery of 1,1,1-Trimethyl-N-(trimethylsilyl)silanamine - dioxosilane (1:1) emerged from research into silane and siloxane chemistry, where the focus was on developing compounds with improved stability and functionality for various industrial and research applications. The compound is synthesized through the reaction of trimethylsilyl chloride with silanamine and dioxosilane precursors under controlled conditions. This process typically involves the use of solvents and catalysts to ensure high yield and purity of the final product. The synthesis of TMTD involves several key steps. First, trimethylsilyl chloride is reacted with an appropriate silanamine to form an intermediate compound. This intermediate is then combined with dioxosilane under specific conditions to yield the final product, 1,1,1-Trimethyl-N-(trimethylsilyl)silanamine - dioxosilane (1:1). The reaction conditions, such as temperature and pressure, are carefully controlled to optimize the reaction and minimize by-products. One of the primary applications of TMTD is in the field of silicone polymer chemistry. The compound acts as a cross-linking agent and stabilizer in the synthesis of silicone-based materials. Due to its ability to form stable bonds with silicon atoms, TMTD enhances the mechanical and thermal properties of silicone polymers, making them suitable for high-performance applications. These materials are used in a variety of industries, including electronics, automotive, and construction, where durability and resistance to extreme conditions are crucial. Additionally, TMTD is employed in the formulation of silicone coatings and sealants. Its presence in these products improves their adhesion to various surfaces and increases their resistance to environmental factors such as moisture, UV radiation, and temperature fluctuations. This makes TMTD-containing coatings and sealants highly effective for protective and insulating applications. In the research realm, TMTD is used as a precursor in the synthesis of other organosilicon compounds. Its unique chemical structure allows it to participate in further reactions, leading to the formation of compounds with tailored properties for specific applications. This versatility is valuable for developing new materials and exploring novel chemical reactions in the laboratory. Moreover, the compound's stability and solubility in organic solvents make it a convenient reagent for chemical processes that require precise control over reaction conditions. Its use in various chemical syntheses and formulations highlights its importance as a functional and versatile component in organosilicon chemistry. In summary, 1,1,1-Trimethyl-N-(trimethylsilyl)silanamine - dioxosilane (1:1) is a significant organosilicon compound with diverse applications in silicone polymer chemistry, coatings, and sealants. Its discovery and development underscore the importance of organosilicon compounds in advancing materials science and industrial applications. References none |
| Market Analysis Reports |
| List of Reports Available for 1,1,1-Trimethyl-N-(trimethylsilyl)silanamine - dioxosilane (1:1) |