Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Epsilon Chimie Chemical Manufacturer | France | Inquire | ||
|---|---|---|---|---|
|
+33 (2) 9842-4650 | |||
|
pierre.cornec@epsilon-chimie.com | |||
| Chemical manufacturer | ||||
| Name | P-(4-Bromophenyl)-Phosphonic Acid |
|---|---|
| Synonyms | Nsc13558; (P-Bromophenyl)Phosphonic Acid; 4-16-00-01083 (Beilstein Handbook Reference) |
| Molecular Structure |  |
| Molecular Formula | C6H6BrO3P |
| Molecular Weight | 236.99 |
| CAS Registry Number | 16839-13-7 |
| SMILES | C1=C(C=CC(=C1)Br)[P](=O)(O)O |
| InChI | 1S/C6H6BrO3P/c7-5-1-3-6(4-2-5)11(8,9)10/h1-4H,(H2,8,9,10) |
| InChIKey | XDGIQCFWQNHSMV-UHFFFAOYSA-N |
| Density | 1.908g/cm3 (Cal.) |
|---|---|
| Boiling point | 395.957°C at 760 mmHg (Cal.) |
| Flash point | 193.268°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for P-(4-Bromophenyl)-Phosphonic Acid |