Online Database of Chemicals from Around the World
| Exclusive Chemistry Ltd. | Russian Federation | Inquire | ||
|---|---|---|---|---|
 |
+7 (903) 713-5556 | |||
 |
info@exchemistry.com | |||
| Chemical manufacturer | ||||
| Name | 2-Bromophenylphosphonic Acid |
|---|---|
| Synonyms | 2-Bromophenylphosphonic Acid; Ec-000.1458; (O-Bromophenyl)Phosphonic Acid |
| Molecular Structure |  |
| Molecular Formula | C6H6BrO3P |
| Molecular Weight | 236.99 |
| CAS Registry Number | 7506-82-3 |
| SMILES | C1=C(C(=CC=C1)Br)[P](O)(O)=O |
| InChI | 1S/C6H6BrO3P/c7-5-3-1-2-4-6(5)11(8,9)10/h1-4H,(H2,8,9,10) |
| InChIKey | JFSDFUSYPBGANG-UHFFFAOYSA-N |
| Density | 1.908g/cm3 (Cal.) |
|---|---|
| Boiling point | 410.79°C at 760 mmHg (Cal.) |
| Flash point | 202.239°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Bromophenylphosphonic Acid |