Online Database of Chemicals from Around the World
|
CAS#: 16913-63-6 Product: 4-Nitrophenyl Dimethyldithiocarbamate No suppilers available for the product. |
| Name | 4-Nitrophenyl Dimethyldithiocarbamate |
|---|---|
| Synonyms | Dimethylaminomethanedithioic Acid (4-Nitrophenyl) Ester; Nsc127879 |
| Molecular Structure |  |
| Molecular Formula | C9H10N2O2S2 |
| Molecular Weight | 242.31 |
| CAS Registry Number | 16913-63-6 |
| EINECS | 240-962-0 |
| SMILES | C1=C(SC(=S)N(C)C)C=CC(=C1)[N+]([O-])=O |
| InChI | 1S/C9H10N2O2S2/c1-10(2)9(14)15-8-5-3-7(4-6-8)11(12)13/h3-6H,1-2H3 |
| InChIKey | BSPPFEBCCBLHGW-UHFFFAOYSA-N |
| Density | 1.368g/cm3 (Cal.) |
|---|---|
| Boiling point | 369.189°C at 760 mmHg (Cal.) |
| Flash point | 177.079°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Nitrophenyl Dimethyldithiocarbamate |