| Ryan Scientific, Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (843)-884-4911 | |||
![]() |
sales@ryansci.com | |||
| Chemical manufacturer | ||||
| Name | 1-(4-Nitrophenyl)-3,3-Dimethyltriazene |
|---|---|
| Synonyms | N-Methyl-N-(4-Nitrophenyl)Azo-Methanamine; N-Methyl-N-(4-Nitrophenyl)Azomethanamine; Dimethyl-(4-Nitrophenyl)Azo-Amine |
| Molecular Structure | ![]() |
| Molecular Formula | C8H10N4O2 |
| Molecular Weight | 194.19 |
| CAS Registry Number | 7227-92-1 |
| SMILES | C1=C(N=NN(C)C)C=CC(=C1)[N+]([O-])=O |
| InChI | 1S/C8H10N4O2/c1-11(2)10-9-7-3-5-8(6-4-7)12(13)14/h3-6H,1-2H3 |
| InChIKey | KUUFZOFMKVIAAW-UHFFFAOYSA-N |
| Density | 1.239g/cm3 (Cal.) |
|---|---|
| Boiling point | 301.799°C at 760 mmHg (Cal.) |
| Flash point | 136.323°C (Cal.) |
| (1) | Anzenbacher, Jr., P. et al.. Polymer nanofibre junctions of attolitre volume serve as zeptomole-scale chemical reactors, Nature Chemistry, 2009 |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 1-(4-Nitrophenyl)-3,3-Dimethyltriazene |