Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (201) 478-8534 | |||
|
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 2,4,5-Trichlorophenyl Chloroformate |
|---|---|
| Synonyms | Chloroformic Acid (2,4,5-Trichlorophenyl) Ester; (2,4,5-Trichlorophenyl) Chloromethanoate; 2,4,5-Trichlorophenyl Chloroformate |
| Molecular Structure |  |
| Molecular Formula | C7H2Cl4O2 |
| Molecular Weight | 259.90 |
| CAS Registry Number | 16947-69-6 |
| EINECS | 241-015-4 |
| SMILES | C1=C(Cl)C(=CC(=C1Cl)Cl)OC(Cl)=O |
| InChI | 1S/C7H2Cl4O2/c8-3-1-5(10)6(2-4(3)9)13-7(11)12/h1-2H |
| InChIKey | ZDCIHNWVXROPMN-UHFFFAOYSA-N |
| Density | 1.647g/cm3 (Cal.) |
|---|---|
| Boiling point | 294.264°C at 760 mmHg (Cal.) |
| Flash point | 125.825°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,4,5-Trichlorophenyl Chloroformate |