Online Database of Chemicals from Around the World
|
CAS#: 5902-69-2 Product: 2,4,5-Trichlorophenyl Chloroacetate No suppilers available for the product. |
| Name | 2,4,5-Trichlorophenyl Chloroacetate |
|---|---|
| Synonyms | 2-Chloroacetic Acid (2,4,5-Trichlorophenyl) Ester; (2,4,5-Trichlorophenyl) 2-Chloroethanoate; 2,4,5-Trichlorfenylester Kyseliny Chloroctove [Czech] |
| Molecular Structure |  |
| Molecular Formula | C8H4Cl4O2 |
| Molecular Weight | 273.93 |
| CAS Registry Number | 5902-69-2 |
| SMILES | C1=C(C(=CC(=C1OC(CCl)=O)Cl)Cl)Cl |
| InChI | 1S/C8H4Cl4O2/c9-3-8(13)14-7-2-5(11)4(10)1-6(7)12/h1-2H,3H2 |
| InChIKey | HERRLRXZMJPBFQ-UHFFFAOYSA-N |
| Density | 1.572g/cm3 (Cal.) |
|---|---|
| Boiling point | 341.335°C at 760 mmHg (Cal.) |
| Flash point | 146.428°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,4,5-Trichlorophenyl Chloroacetate |