|
CAS#: 17014-39-0 Product: 2,7-Dibromo-10-Methyl-9(10H)-Acridinone No suppilers available for the product. |
| Name | 2,7-Dibromo-10-Methyl-9(10H)-Acridinone |
|---|---|
| Synonyms | 2,7-Dibromo-10-methyl-9(10H)-acridinone #; 2,7-Dibromo-10-methylacridone; 9-Acridanone, 2,7-dibromo-10-methyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C14H9Br2NO |
| Molecular Weight | 367.04 |
| CAS Registry Number | 17014-39-0 |
| SMILES | Brc3cc2C(=O)c1c(ccc(Br)c1)N(c2cc3)C |
| InChI | 1S/C14H9Br2NO/c1-17-12-4-2-8(15)6-10(12)14(18)11-7-9(16)3-5-13(11)17/h2-7H,1H3 |
| InChIKey | JVILQLLOKMSADY-UHFFFAOYSA-N |
| Density | 1.782g/cm3 (Cal.) |
|---|---|
| Boiling point | 478.364°C at 760 mmHg (Cal.) |
| Flash point | 243.106°C (Cal.) |
| Refractive index | 1.677 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,7-Dibromo-10-Methyl-9(10H)-Acridinone |