Online Database of Chemicals from Around the World
|
CAS#: 741737-01-9 Product: 3,5-Dibromo-2-methoxy-6-(trifluoromethyl)pyridine No suppilers available for the product. |
| Name | 3,5-Dibromo-2-methoxy-6-(trifluoromethyl)pyridine |
|---|---|
| Synonyms | 3,5-Dibrom-2-methoxy-6-(trifluormethyl)pyridin; 3,5-Dibromo-2-methoxy-6-(trifluoromethyl)pyridine; 3,5-Dibromo-2-méthoxy-6-(trifluorométhyl)pyridine |
| Molecular Structure |  |
| Molecular Formula | C7H4Br2F3NO |
| Molecular Weight | 334.92 |
| CAS Registry Number | 741737-01-9 |
| SMILES | COc1c(cc(c(n1)C(F)(F)F)Br)Br |
| InChI | 1S/C7H4Br2F3NO/c1-14-6-4(9)2-3(8)5(13-6)7(10,11)12/h2H,1H3 |
| InChIKey | FXTPBHSJYSTYIS-UHFFFAOYSA-N |
| Density | 1.9±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 241.0±40.0°C at 760 mmHg (Cal.) |
| Flash point | 99.6±27.3°C (Cal.) |
| Refractive index | 1.507 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,5-Dibromo-2-methoxy-6-(trifluoromethyl)pyridine |